C13H6F16N2 — CID 15979558
2,2-bis(2,2,3,3,4,4,5,5-octafluoropentyl)propanedinitrile (PubChem CID 15979558) has the molecular formula C13H6F16N2 and a molecular weight of 494.17 g/mol. Its IUPAC name is 2,2-bis(2,2,3,3,4,4,5,5-octafluoropentyl)propanedinitrile.
| Compound Name | 2,2-bis(2,2,3,3,4,4,5,5-octafluoropentyl)propanedinitrile |
|---|---|
| PubChem CID | 15979558 |
| Molecular Formula | C13H6F16N2 |
| Molecular Weight | 494.17 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 2,2-bis(2,2,3,3,4,4,5,5-octafluoropentyl)propanedinitrile |
| SMILES | N#CC(C#N)(CC(F)(F)C(F)(F)C(F)(F)C(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H6F16N2/c14-5(15)10(22,23)12(26,27)8(18,19)1-7(3-30,4-31)2-9(20,21)13(28,29)11(24,25)6(16)17/h5-6H,1-2H2 |
| InChIKey | WETXMBMBFQSCGP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.17 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|