C24H30N2O4 — CID 159795655
benzyl N-(4-methyl-1-oxopentan-2-yl)carbamate;3,4-dihydro-2H-quinoline-1-carbaldehyde (PubChem CID 159795655) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is benzyl N-(4-methyl-1-oxopentan-2-yl)carbamate;3,4-dihydro-2H-quinoline-1-carbaldehyde.
| Compound Name | benzyl N-(4-methyl-1-oxopentan-2-yl)carbamate;3,4-dihydro-2H-quinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 159795655 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | benzyl N-(4-methyl-1-oxopentan-2-yl)carbamate;3,4-dihydro-2H-quinoline-1-carbaldehyde |
| SMILES | CC(C)CC(C=O)NC(=O)OCc1ccccc1.O=CN1CCCc2ccccc21 |
| InChI | InChI=1S/C14H19NO3.C10H11NO/c1-11(2)8-13(9-16)15-14(17)18-10-12-6-4-3-5-7-12;12-8-11-7-3-5-9-4-1-2-6-10(9)11/h3-7,9,11,13H,8,10H2,1-2H3,(H,15,17);1-2,4,6,8H,3,5,7H2 |
| InChIKey | NJDGFZWTQXMLDO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|