About (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane
(2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane (PubChem CID 159795910) has the molecular formula C18H33N3O
and a molecular weight of 307.48 g/mol. Its IUPAC name is (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane.
Molecular Properties
| Compound Name | (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane |
| PubChem CID | 159795910 |
| Molecular Formula | C18H33N3O |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane |
| SMILES | C.CC[C@H](NCC(N)Cc1ccccc1)C(=O)NCC(C)C |
| InChI | InChI=1S/C17H29N3O.CH4/c1-4-16(17(21)20-11-13(2)3)19-12-15(18)10-14-8-6-5-7-9-14;/h5-9,13,15-16,19H,4,10-12,18H2,1-3H3,(H,20,21);1H4/t15?,16-;/m0./s1 |
| InChIKey | NJECCPQLRLXINE-UFUZRDLVSA-N |
| XLogP | 2.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane?
The IUPAC name of (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane (CID 159795910) is (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane.
What is the SMILES notation for (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane?
The canonical SMILES for (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane is C.CC[C@H](NCC(N)Cc1ccccc1)C(=O)NCC(C)C.
What is the InChIKey of (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane?
The InChIKey is NJECCPQLRLXINE-UFUZRDLVSA-N. The full InChI is InChI=1S/C17H29N3O.CH4/c1-4-16(17(21)20-11-13(2)3)19-12-15(18)10-14-8-6-5-7-9-14;/h5-9,13,15-16,19H,4,10-12,18H2,1-3H3,(H,20,21);1H4/t15?,16-;/m0./s1.
What are the key properties of (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane?
(2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane has a molecular weight of 307.48 g/mol, XLogP of 2.33, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2-amino-3-phenylpropyl)amino]-N-(2-methylpropyl)butanamide;methane is sourced from PubChem (CID 159795910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).