About nickel(2+);tetrakis(4-hydroxybutyl)azanium
nickel(2+);tetrakis(4-hydroxybutyl)azanium (PubChem CID 159796209) has the molecular formula C16H36NNiO4+3
and a molecular weight of 365.16 g/mol. Its IUPAC name is nickel(2+);tetrakis(4-hydroxybutyl)azanium.
Molecular Properties
| Compound Name | nickel(2+);tetrakis(4-hydroxybutyl)azanium |
| PubChem CID | 159796209 |
| Molecular Formula | C16H36NNiO4+3 |
| Molecular Weight | 365.16 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | nickel(2+);tetrakis(4-hydroxybutyl)azanium |
| SMILES | OCCCC[N+](CCCCO)(CCCCO)CCCCO.[Ni+2] |
| InChI | InChI=1S/C16H36NO4.Ni/c18-13-5-1-9-17(10-2-6-14-19,11-3-7-15-20)12-4-8-16-21;/h18-21H,1-16H2;/q+1;+2 |
| InChIKey | NJFAIAXZUQSVOW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze nickel(2+);tetrakis(4-hydroxybutyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);tetrakis(4-hydroxybutyl)azanium?
The IUPAC name of nickel(2+);tetrakis(4-hydroxybutyl)azanium (CID 159796209) is nickel(2+);tetrakis(4-hydroxybutyl)azanium.
What is the SMILES notation for nickel(2+);tetrakis(4-hydroxybutyl)azanium?
The canonical SMILES for nickel(2+);tetrakis(4-hydroxybutyl)azanium is OCCCC[N+](CCCCO)(CCCCO)CCCCO.[Ni+2].
What is the InChIKey of nickel(2+);tetrakis(4-hydroxybutyl)azanium?
The InChIKey is NJFAIAXZUQSVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36NO4.Ni/c18-13-5-1-9-17(10-2-6-14-19,11-3-7-15-20)12-4-8-16-21;/h18-21H,1-16H2;/q+1;+2.
What are the key properties of nickel(2+);tetrakis(4-hydroxybutyl)azanium?
nickel(2+);tetrakis(4-hydroxybutyl)azanium has a molecular weight of 365.16 g/mol, XLogP of 0.89, 16 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);tetrakis(4-hydroxybutyl)azanium is sourced from PubChem (CID 159796209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).