C5H12O — CID 159796490
2,2,3,3-tetradeuteriopentan-1-ol (PubChem CID 159796490) has the molecular formula C5H12O and a molecular weight of 92.17 g/mol. Its IUPAC name is 2,2,3,3-tetradeuteriopentan-1-ol.
| Compound Name | 2,2,3,3-tetradeuteriopentan-1-ol |
|---|---|
| PubChem CID | 159796490 |
| Molecular Formula | C5H12O |
| Molecular Weight | 92.17 g/mol |
| Exact Mass | 92.11 |
| IUPAC Name | 2,2,3,3-tetradeuteriopentan-1-ol |
| SMILES | [2H]C([2H])(CC)C([2H])([2H])CO |
| InChI | InChI=1S/C5H12O/c1-2-3-4-5-6/h6H,2-5H2,1H3/i3D2,4D2 |
| InChIKey | AMQJEAYHLZJPGS-KHORGVISSA-N |
| XLogP | 1.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 92.17 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |