C12H5F15N2 — CID 15979663
2-(2,2,3,3,4,4,4-heptafluorobutyl)-2-(2,2,3,3,4,4,5,5-octafluoropentyl)propanedinitrile (PubChem CID 15979663) has the molecular formula C12H5F15N2 and a molecular weight of 462.16 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutyl)-2-(2,2,3,3,4,4,5,5-octafluoropentyl)propanedinitrile.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutyl)-2-(2,2,3,3,4,4,5,5-octafluoropentyl)propanedinitrile |
|---|---|
| PubChem CID | 15979663 |
| Molecular Formula | C12H5F15N2 |
| Molecular Weight | 462.16 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutyl)-2-(2,2,3,3,4,4,5,5-octafluoropentyl)propanedinitrile |
| SMILES | N#CC(C#N)(CC(F)(F)C(F)(F)C(F)(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H5F15N2/c13-5(14)9(19,20)10(21,22)7(15,16)1-6(3-28,4-29)2-8(17,18)11(23,24)12(25,26)27/h5H,1-2H2 |
| InChIKey | PJDKEFKELOIZQG-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.16 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|