C11H5F13N2 — CID 15979664
2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(2,2,3,3,3-pentafluoropropyl)propanedinitrile (PubChem CID 15979664) has the molecular formula C11H5F13N2 and a molecular weight of 412.15 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(2,2,3,3,3-pentafluoropropyl)propanedinitrile.
| Compound Name | 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(2,2,3,3,3-pentafluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 15979664 |
| Molecular Formula | C11H5F13N2 |
| Molecular Weight | 412.15 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(2,2,3,3,3-pentafluoropropyl)propanedinitrile |
| SMILES | N#CC(C#N)(CC(F)(F)C(F)(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H5F13N2/c12-5(13)9(18,19)10(20,21)7(14,15)1-6(3-25,4-26)2-8(16,17)11(22,23)24/h5H,1-2H2 |
| InChIKey | QJDCACXCOPXWDX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.15 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|