C12H8F12N2 — CID 15979665
2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-(3,3,3-trifluoropropyl)propanedinitrile (PubChem CID 15979665) has the molecular formula C12H8F12N2 and a molecular weight of 408.19 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-(3,3,3-trifluoropropyl)propanedinitrile.
| Compound Name | 2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 15979665 |
| Molecular Formula | C12H8F12N2 |
| Molecular Weight | 408.19 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCC(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F12N2/c13-8(14,10(18,19)11(20,21)12(22,23)24)3-1-7(5-25,6-26)2-4-9(15,16)17/h1-4H2 |
| InChIKey | ABPLLCBBZUJEJN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.19 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|