C20H25N7OS — CID 15979745
N'-[5-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]-3-pyridinyl]propane-1,3-diamine (PubChem CID 15979745) has the molecular formula C20H25N7OS and a molecular weight of 411.54 g/mol. Its IUPAC name is N'-[5-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]-3-pyridinyl]propane-1,3-diamine.
| Compound Name | N'-[5-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]-3-pyridinyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 15979745 |
| Molecular Formula | C20H25N7OS |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N'-[5-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]-3-pyridinyl]propane-1,3-diamine |
| SMILES | NCCCNc1cncc(-c2cnc(Nc3cc(N4CCOCC4)ccn3)s2)c1 |
| InChI | InChI=1S/C20H25N7OS/c21-3-1-4-23-16-10-15(12-22-13-16)18-14-25-20(29-18)26-19-11-17(2-5-24-19)27-6-8-28-9-7-27/h2,5,10-14,23H,1,3-4,6-9,21H2,(H,24,25,26) |
| InChIKey | XJKVAGFPVGIJPC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|