C37H37N7O4S — CID 159800056
4-[3-(oxan-3-yl)pyrazin-2-yl]oxyaniline;N-[4-[3-(oxan-3-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine (PubChem CID 159800056) has the molecular formula C37H37N7O4S and a molecular weight of 675.82 g/mol. Its IUPAC name is 4-[3-(oxan-3-yl)pyrazin-2-yl]oxyaniline;N-[4-[3-(oxan-3-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine.
| Compound Name | 4-[3-(oxan-3-yl)pyrazin-2-yl]oxyaniline;N-[4-[3-(oxan-3-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 159800056 |
| Molecular Formula | C37H37N7O4S |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 675.26 |
| IUPAC Name | 4-[3-(oxan-3-yl)pyrazin-2-yl]oxyaniline;N-[4-[3-(oxan-3-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine |
| SMILES | Nc1ccc(Oc2nccnc2C2CCCOC2)cc1.c1ccc2sc(Nc3ccc(Oc4nccnc4C4CCCOC4)cc3)nc2c1 |
| InChI | InChI=1S/C22H20N4O2S.C15H17N3O2/c1-2-6-19-18(5-1)26-22(29-19)25-16-7-9-17(10-8-16)28-21-20(23-11-12-24-21)15-4-3-13-27-14-15;16-12-3-5-13(6-4-12)20-15-14(17-7-8-18-15)11-2-1-9-19-10-11/h1-2,5-12,15H,3-4,13-14H2,(H,25,26);3-8,11H,1-2,9-10,16H2 |
| InChIKey | NJRBMFUSZRUEDD-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 139.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|