C15H28N2OS2 — CID 159800437
(R)-N-[(1S)-1-(6-tert-butyl-3-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide;sulfane (PubChem CID 159800437) has the molecular formula C15H28N2OS2 and a molecular weight of 316.54 g/mol. Its IUPAC name is (R)-N-[(1S)-1-(6-tert-butyl-3-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide;sulfane.
| Compound Name | (R)-N-[(1S)-1-(6-tert-butyl-3-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide;sulfane |
|---|---|
| PubChem CID | 159800437 |
| Molecular Formula | C15H28N2OS2 |
| Molecular Weight | 316.54 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (R)-N-[(1S)-1-(6-tert-butyl-3-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide;sulfane |
| SMILES | C[C@H](N[S@](=O)C(C)(C)C)c1ccc(C(C)(C)C)nc1.S |
| InChI | InChI=1S/C15H26N2OS.H2S/c1-11(17-19(18)15(5,6)7)12-8-9-13(16-10-12)14(2,3)4;/h8-11,17H,1-7H3;1H2/t11-,19+;/m0./s1 |
| InChIKey | NJSICGRWYGSTIJ-WPRSOCCZSA-N |
| XLogP | 3.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |