About piperidin-3-ol;triethylborane
piperidin-3-ol;triethylborane (PubChem CID 159801081) has the molecular formula C11H26BNO
and a molecular weight of 199.15 g/mol. Its IUPAC name is piperidin-3-ol;triethylborane.
Molecular Properties
| Compound Name | piperidin-3-ol;triethylborane |
| PubChem CID | 159801081 |
| Molecular Formula | C11H26BNO |
| Molecular Weight | 199.15 g/mol |
| Exact Mass | 199.21 |
| IUPAC Name | piperidin-3-ol;triethylborane |
| SMILES | CCB(CC)CC.OC1CCCNC1 |
| InChI | InChI=1S/C6H15B.C5H11NO/c1-4-7(5-2)6-3;7-5-2-1-3-6-4-5/h4-6H2,1-3H3;5-7H,1-4H2 |
| InChIKey | NJUIFAVIPBPHSS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.15 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze piperidin-3-ol;triethylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-3-ol;triethylborane?
The IUPAC name of piperidin-3-ol;triethylborane (CID 159801081) is piperidin-3-ol;triethylborane.
What is the SMILES notation for piperidin-3-ol;triethylborane?
The canonical SMILES for piperidin-3-ol;triethylborane is CCB(CC)CC.OC1CCCNC1.
What is the InChIKey of piperidin-3-ol;triethylborane?
The InChIKey is NJUIFAVIPBPHSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15B.C5H11NO/c1-4-7(5-2)6-3;7-5-2-1-3-6-4-5/h4-6H2,1-3H3;5-7H,1-4H2.
What are the key properties of piperidin-3-ol;triethylborane?
piperidin-3-ol;triethylborane has a molecular weight of 199.15 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-3-ol;triethylborane is sourced from PubChem (CID 159801081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).