About N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide
N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide (PubChem CID 159801167) has the molecular formula C20H34N6O
and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide |
| PubChem CID | 159801167 |
| Molecular Formula | C20H34N6O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ncnc2c1nc(NCCCC(C)(C)C)n2C(C)(C)C |
| InChI | InChI=1S/C20H34N6O/c1-13(2)17(27)25-15-14-16(23-12-22-15)26(20(6,7)8)18(24-14)21-11-9-10-19(3,4)5/h12-13H,9-11H2,1-8H3,(H,21,24)(H,22,23,25,27) |
| InChIKey | SEERFYHKTOTBKI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide?
The IUPAC name of N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide (CID 159801167) is N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide.
What is the SMILES notation for N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide?
The canonical SMILES for N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide is CC(C)C(=O)Nc1ncnc2c1nc(NCCCC(C)(C)C)n2C(C)(C)C.
What is the InChIKey of N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide?
The InChIKey is SEERFYHKTOTBKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N6O/c1-13(2)17(27)25-15-14-16(23-12-22-15)26(20(6,7)8)18(24-14)21-11-9-10-19(3,4)5/h12-13H,9-11H2,1-8H3,(H,21,24)(H,22,23,25,27).
What are the key properties of N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide?
N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide has a molecular weight of 374.53 g/mol, XLogP of 4.41, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[9-tert-butyl-8-(4,4-dimethylpentylamino)purin-6-yl]-2-methylpropanamide is sourced from PubChem (CID 159801167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).