C16H14ClF5N2O — CID 15980186
9-chloro-1,2-dimethyl-3-(2,2,3,3,3-pentafluoropropyl)-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one (PubChem CID 15980186) has the molecular formula C16H14ClF5N2O and a molecular weight of 380.74 g/mol. Its IUPAC name is 9-chloro-1,2-dimethyl-3-(2,2,3,3,3-pentafluoropropyl)-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one.
| Compound Name | 9-chloro-1,2-dimethyl-3-(2,2,3,3,3-pentafluoropropyl)-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one |
|---|---|
| PubChem CID | 15980186 |
| Molecular Formula | C16H14ClF5N2O |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 9-chloro-1,2-dimethyl-3-(2,2,3,3,3-pentafluoropropyl)-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one |
| SMILES | CC1c2c(ccc3[nH]c(=O)cc(Cl)c23)N(CC(F)(F)C(F)(F)F)C1C |
| InChI | InChI=1S/C16H14ClF5N2O/c1-7-8(2)24(6-15(18,19)16(20,21)22)11-4-3-10-14(13(7)11)9(17)5-12(25)23-10/h3-5,7-8H,6H2,1-2H3,(H,23,25) |
| InChIKey | WZEQHSYQEBVNRJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|