C32H46O9S — CID 159803938
[(1S,2S,5S,8R,9R,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7,15-dioxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-(butylsulfonylmethyl)cyclohexane-1-carboxylate (PubChem CID 159803938) has the molecular formula C32H46O9S and a molecular weight of 606.78 g/mol. Its IUPAC name is [(1S,2S,5S,8R,9R,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7,15-dioxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-(butylsulfonylmethyl)cyclohexane-1-carboxylate.
| Compound Name | [(1S,2S,5S,8R,9R,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7,15-dioxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-(butylsulfonylmethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 159803938 |
| Molecular Formula | C32H46O9S |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | [(1S,2S,5S,8R,9R,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7,15-dioxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-(butylsulfonylmethyl)cyclohexane-1-carboxylate |
| SMILES | C=C1C(=O)[C@]23[C@H](OC(=O)C4CCC(CS(=O)(=O)CCCC)CC4)[C@H]1CC[C@H]2[C@@]12CO[C@@]3(O)[C@@H](O)[C@@H]1C(C)(C)CCC2=O |
| InChI | InChI=1S/C32H46O9S/c1-5-6-15-42(38,39)16-19-7-9-20(10-8-19)28(36)41-27-21-11-12-22-30-17-40-32(37,31(22,27)25(34)18(21)2)26(35)24(30)29(3,4)14-13-23(30)33/h19-22,24,26-27,35,37H,2,5-17H2,1,3-4H3/t19?,20?,21-,22-,24+,26-,27+,30+,31-,32-/m0/s1 |
| InChIKey | MUVBOUDTJIIDFT-BJCKFYADSA-N |
| XLogP | 3.16 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|