About tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine
tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine (PubChem CID 159804477) has the molecular formula C17H34Cl2N4O2
and a molecular weight of 397.39 g/mol. Its IUPAC name is tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine.
Molecular Properties
| Compound Name | tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine |
| PubChem CID | 159804477 |
| Molecular Formula | C17H34Cl2N4O2 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCl)CC1.ClCCN1CCNCC1 |
| InChI | InChI=1S/C11H21ClN2O2.C6H13ClN2/c1-11(2,3)16-10(15)14-8-6-13(5-4-12)7-9-14;7-1-4-9-5-2-8-3-6-9/h4-9H2,1-3H3;8H,1-6H2 |
| InChIKey | NKFFVBJQYXAPNB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine?
The IUPAC name of tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine (CID 159804477) is tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine.
What is the SMILES notation for tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine?
The canonical SMILES for tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine is CC(C)(C)OC(=O)N1CCN(CCCl)CC1.ClCCN1CCNCC1.
What is the InChIKey of tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine?
The InChIKey is NKFFVBJQYXAPNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21ClN2O2.C6H13ClN2/c1-11(2,3)16-10(15)14-8-6-13(5-4-12)7-9-14;7-1-4-9-5-2-8-3-6-9/h4-9H2,1-3H3;8H,1-6H2.
What are the key properties of tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine?
tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine has a molecular weight of 397.39 g/mol, XLogP of 1.91, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate;1-(2-chloroethyl)piperazine is sourced from PubChem (CID 159804477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).