C6H9N5S3 — CID 159804778
5-methyl-3H-1,3,4-thiadiazole-2-thione;4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 159804778) has the molecular formula C6H9N5S3 and a molecular weight of 247.37 g/mol. Its IUPAC name is 5-methyl-3H-1,3,4-thiadiazole-2-thione;4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 5-methyl-3H-1,3,4-thiadiazole-2-thione;4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 159804778 |
| Molecular Formula | C6H9N5S3 |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 5-methyl-3H-1,3,4-thiadiazole-2-thione;4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)s1.Cn1cn[nH]c1=S |
| InChI | InChI=1S/C3H5N3S.C3H4N2S2/c1-6-2-4-5-3(6)7;1-2-4-5-3(6)7-2/h2H,1H3,(H,5,7);1H3,(H,5,6) |
| InChIKey | NKGCIYGWDZWMEG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|