C28H23N7 — CID 15980490
[4-[9-phenyl-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]methanamine (PubChem CID 15980490) has the molecular formula C28H23N7 and a molecular weight of 457.54 g/mol. Its IUPAC name is [4-[9-phenyl-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]methanamine.
| Compound Name | [4-[9-phenyl-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 15980490 |
| Molecular Formula | C28H23N7 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | [4-[9-phenyl-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-8-yl]phenyl]methanamine |
| SMILES | NCc1ccc(-c2nc3ccn4c(-c5n[nH]c6c5CCC6)nnc4c3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23N7/c29-16-17-9-11-19(12-10-17)25-21(18-5-2-1-3-6-18)15-22-23(30-25)13-14-35-27(22)33-34-28(35)26-20-7-4-8-24(20)31-32-26/h1-3,5-6,9-15H,4,7-8,16,29H2,(H,31,32) |
| InChIKey | JZJVLSQKSSHXFI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |