C23H19F3N2O3 — CID 15980497
1-(2,5-dimethoxyphenyl)-2,2,2-trifluoro-1-(1-phenylindazol-5-yl)ethanol (PubChem CID 15980497) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2,2,2-trifluoro-1-(1-phenylindazol-5-yl)ethanol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2,2,2-trifluoro-1-(1-phenylindazol-5-yl)ethanol |
|---|---|
| PubChem CID | 15980497 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2,2,2-trifluoro-1-(1-phenylindazol-5-yl)ethanol |
| SMILES | COc1ccc(OC)c(C(O)(c2ccc3c(cnn3-c3ccccc3)c2)C(F)(F)F)c1 |
| InChI | InChI=1S/C23H19F3N2O3/c1-30-18-9-11-21(31-2)19(13-18)22(29,23(24,25)26)16-8-10-20-15(12-16)14-27-28(20)17-6-4-3-5-7-17/h3-14,29H,1-2H3 |
| InChIKey | VSHLNXPDVNBDRH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |