C35H34Br2N4O5S — CID 159804982
3-bromo-5-isocyano-1H-indole;3-bromo-5-isocyano-1-(oxan-4-yl)indole;oxan-4-yl 4-methylbenzenesulfonate (PubChem CID 159804982) has the molecular formula C35H34Br2N4O5S and a molecular weight of 782.55 g/mol. Its IUPAC name is 3-bromo-5-isocyano-1H-indole;3-bromo-5-isocyano-1-(oxan-4-yl)indole;oxan-4-yl 4-methylbenzenesulfonate.
| Compound Name | 3-bromo-5-isocyano-1H-indole;3-bromo-5-isocyano-1-(oxan-4-yl)indole;oxan-4-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159804982 |
| Molecular Formula | C35H34Br2N4O5S |
| Molecular Weight | 782.55 g/mol |
| Exact Mass | 780.06 |
| IUPAC Name | 3-bromo-5-isocyano-1H-indole;3-bromo-5-isocyano-1-(oxan-4-yl)indole;oxan-4-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCOCC2)cc1.[C-]#[N+]c1ccc2[nH]cc(Br)c2c1.[C-]#[N+]c1ccc2c(c1)c(Br)cn2C1CCOCC1 |
| InChI | InChI=1S/C14H13BrN2O.C12H16O4S.C9H5BrN2/c1-16-10-2-3-14-12(8-10)13(15)9-17(14)11-4-6-18-7-5-11;1-10-2-4-12(5-3-10)17(13,14)16-11-6-8-15-9-7-11;1-11-6-2-3-9-7(4-6)8(10)5-12-9/h2-3,8-9,11H,4-7H2;2-5,11H,6-9H2,1H3;2-5,12H |
| InChIKey | NKGVJBJATVHNQL-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.55 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|