C9H14O6S — CID 159805657
1,2-dimethoxy-4-methylsulfonylcyclohexa-3,5-diene-1,2-diol (PubChem CID 159805657) has the molecular formula C9H14O6S and a molecular weight of 250.27 g/mol. Its IUPAC name is 1,2-dimethoxy-4-methylsulfonylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | 1,2-dimethoxy-4-methylsulfonylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 159805657 |
| Molecular Formula | C9H14O6S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1,2-dimethoxy-4-methylsulfonylcyclohexa-3,5-diene-1,2-diol |
| SMILES | COC1(O)C=CC(S(C)(=O)=O)=CC1(O)OC |
| InChI | InChI=1S/C9H14O6S/c1-14-8(10)5-4-7(16(3,12)13)6-9(8,11)15-2/h4-6,10-11H,1-3H3 |
| InChIKey | NKIVXTXMSLLWCU-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|