About cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate
cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate (PubChem CID 159805951) has the molecular formula C9H20NO2S-
and a molecular weight of 206.33 g/mol. Its IUPAC name is cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate.
Molecular Properties
| Compound Name | cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate |
| PubChem CID | 159805951 |
| Molecular Formula | C9H20NO2S- |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate |
| SMILES | C1CCC1.CNC(C)(C)CS(=O)[O-] |
| InChI | InChI=1S/C5H13NO2S.C4H8/c1-5(2,6-3)4-9(7)8;1-2-4-3-1/h6H,4H2,1-3H3,(H,7,8);1-4H2/p-1 |
| InChIKey | OLQLLNDJSHBOFF-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate?
The IUPAC name of cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate (CID 159805951) is cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate.
What is the SMILES notation for cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate?
The canonical SMILES for cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate is C1CCC1.CNC(C)(C)CS(=O)[O-].
What is the InChIKey of cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate?
The InChIKey is OLQLLNDJSHBOFF-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H13NO2S.C4H8/c1-5(2,6-3)4-9(7)8;1-2-4-3-1/h6H,4H2,1-3H3,(H,7,8);1-4H2/p-1.
What are the key properties of cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate?
cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate has a molecular weight of 206.33 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane;2-methyl-2-(methylamino)propane-1-sulfinate is sourced from PubChem (CID 159805951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).