About 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide
4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide (PubChem CID 15980811) has the molecular formula C25H17F3N4O2
and a molecular weight of 462.43 g/mol. Its IUPAC name is 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide.
Molecular Properties
| Compound Name | 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide |
| PubChem CID | 15980811 |
| Molecular Formula | C25H17F3N4O2 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide |
| SMILES | NC(=O)c1cnc2ccccc2c1C(O)(c1ccc2c(cnn2-c2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C25H17F3N4O2/c26-25(27,28)24(34,22-18-8-4-5-9-20(18)30-14-19(22)23(29)33)16-10-11-21-15(12-16)13-31-32(21)17-6-2-1-3-7-17/h1-14,34H,(H2,29,33) |
| InChIKey | PLWUPDQFGPDMFV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide?
The IUPAC name of 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide (CID 15980811) is 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide.
What is the SMILES notation for 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide?
The canonical SMILES for 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide is NC(=O)c1cnc2ccccc2c1C(O)(c1ccc2c(cnn2-c2ccccc2)c1)C(F)(F)F.
What is the InChIKey of 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide?
The InChIKey is PLWUPDQFGPDMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17F3N4O2/c26-25(27,28)24(34,22-18-8-4-5-9-20(18)30-14-19(22)23(29)33)16-10-11-21-15(12-16)13-31-32(21)17-6-2-1-3-7-17/h1-14,34H,(H2,29,33).
What are the key properties of 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide?
4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide has a molecular weight of 462.43 g/mol, XLogP of 4.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]quinoline-3-carboxamide is sourced from PubChem (CID 15980811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).