C26H27F4N3O2 — CID 15980852
9-[3-(5-fluoro-1H-indol-3-yl)propyl-(3,3,3-trifluoropropyl)amino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one (PubChem CID 15980852) has the molecular formula C26H27F4N3O2 and a molecular weight of 489.51 g/mol. Its IUPAC name is 9-[3-(5-fluoro-1H-indol-3-yl)propyl-(3,3,3-trifluoropropyl)amino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one.
| Compound Name | 9-[3-(5-fluoro-1H-indol-3-yl)propyl-(3,3,3-trifluoropropyl)amino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one |
|---|---|
| PubChem CID | 15980852 |
| Molecular Formula | C26H27F4N3O2 |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 9-[3-(5-fluoro-1H-indol-3-yl)propyl-(3,3,3-trifluoropropyl)amino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one |
| SMILES | O=C1NCCc2ccc3c(c21)CC(N(CCCc1c[nH]c2ccc(F)cc12)CCC(F)(F)F)CO3 |
| InChI | InChI=1S/C26H27F4N3O2/c27-18-4-5-22-20(12-18)17(14-32-22)2-1-10-33(11-8-26(28,29)30)19-13-21-23(35-15-19)6-3-16-7-9-31-25(34)24(16)21/h3-6,12,14,19,32H,1-2,7-11,13,15H2,(H,31,34) |
| InChIKey | SPGIAGWDWLGCMY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |