C23H23F2N3O2 — CID 15980853
6-fluoro-9-[3-(5-fluoro-1H-indol-3-yl)propylamino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one (PubChem CID 15980853) has the molecular formula C23H23F2N3O2 and a molecular weight of 411.45 g/mol. Its IUPAC name is 6-fluoro-9-[3-(5-fluoro-1H-indol-3-yl)propylamino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one.
| Compound Name | 6-fluoro-9-[3-(5-fluoro-1H-indol-3-yl)propylamino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one |
|---|---|
| PubChem CID | 15980853 |
| Molecular Formula | C23H23F2N3O2 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 6-fluoro-9-[3-(5-fluoro-1H-indol-3-yl)propylamino]-2,3,4,8,9,10-hexahydropyrano[2,3-h]isoquinolin-1-one |
| SMILES | O=C1NCCc2cc(F)c3c(c21)CC(NCCCc1c[nH]c2ccc(F)cc12)CO3 |
| InChI | InChI=1S/C23H23F2N3O2/c24-15-3-4-20-17(9-15)14(11-28-20)2-1-6-26-16-10-18-21-13(5-7-27-23(21)29)8-19(25)22(18)30-12-16/h3-4,8-9,11,16,26,28H,1-2,5-7,10,12H2,(H,27,29) |
| InChIKey | NFJKAVIMGUBTOG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|