C25H30N2O4S — CID 159808571
(E)-3-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-4-[(1S,3R)-3-hydroxycyclopentyl]-1-(1-methylpyrazol-3-yl)but-3-en-2-one (PubChem CID 159808571) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is (E)-3-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-4-[(1S,3R)-3-hydroxycyclopentyl]-1-(1-methylpyrazol-3-yl)but-3-en-2-one.
| Compound Name | (E)-3-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-4-[(1S,3R)-3-hydroxycyclopentyl]-1-(1-methylpyrazol-3-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 159808571 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (E)-3-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-4-[(1S,3R)-3-hydroxycyclopentyl]-1-(1-methylpyrazol-3-yl)but-3-en-2-one |
| SMILES | Cn1ccc(CC(=O)/C(=C/[C@H]2CC[C@@H](O)C2)c2ccc(S(=O)(=O)C3CC3)c(C3CC3)c2)n1 |
| InChI | InChI=1S/C25H30N2O4S/c1-27-11-10-19(26-27)15-24(29)22(13-16-2-6-20(28)12-16)18-5-9-25(23(14-18)17-3-4-17)32(30,31)21-7-8-21/h5,9-11,13-14,16-17,20-21,28H,2-4,6-8,12,15H2,1H3/b22-13+/t16-,20+/m0/s1 |
| InChIKey | NKSKQZUSIOIWJG-KSWTUVBBSA-N |
| XLogP | 3.59 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|