C19H14N2O3S2 — CID 15981074
N-(2-oxo-5-thiophen-3-yl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl)methanesulfonamide (PubChem CID 15981074) has the molecular formula C19H14N2O3S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is N-(2-oxo-5-thiophen-3-yl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl)methanesulfonamide.
| Compound Name | N-(2-oxo-5-thiophen-3-yl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl)methanesulfonamide |
|---|---|
| PubChem CID | 15981074 |
| Molecular Formula | C19H14N2O3S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | N-(2-oxo-5-thiophen-3-yl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2ccc3ncc(-c4ccsc4)cc3c(=O)c2c1 |
| InChI | InChI=1S/C19H14N2O3S2/c1-26(23,24)21-15-4-2-12-3-5-18-17(19(22)16(12)9-15)8-14(10-20-18)13-6-7-25-11-13/h2-11,21H,1H3 |
| InChIKey | SOMXERKTVVUGIZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |