C25H24N10O2 — CID 159811248
methane;3-nitro-5-pyridin-4-yl-7H-pyrrolo[3,4-b]pyridin-2-amine;5-pyridin-4-yl-7H-pyrrolo[3,4-b]pyridine-2,3-diamine (PubChem CID 159811248) has the molecular formula C25H24N10O2 and a molecular weight of 496.54 g/mol. Its IUPAC name is methane;3-nitro-5-pyridin-4-yl-7H-pyrrolo[3,4-b]pyridin-2-amine;5-pyridin-4-yl-7H-pyrrolo[3,4-b]pyridine-2,3-diamine.
| Compound Name | methane;3-nitro-5-pyridin-4-yl-7H-pyrrolo[3,4-b]pyridin-2-amine;5-pyridin-4-yl-7H-pyrrolo[3,4-b]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 159811248 |
| Molecular Formula | C25H24N10O2 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | methane;3-nitro-5-pyridin-4-yl-7H-pyrrolo[3,4-b]pyridin-2-amine;5-pyridin-4-yl-7H-pyrrolo[3,4-b]pyridine-2,3-diamine |
| SMILES | C.Nc1cc2c(nc1N)CN=C2c1ccncc1.Nc1nc2c(cc1[N+](=O)[O-])C(c1ccncc1)=NC2 |
| InChI | InChI=1S/C12H9N5O2.C12H11N5.CH4/c13-12-10(17(18)19)5-8-9(16-12)6-15-11(8)7-1-3-14-4-2-7;13-9-5-8-10(17-12(9)14)6-16-11(8)7-1-3-15-4-2-7;/h1-5H,6H2,(H2,13,16);1-5H,6,13H2,(H2,14,17);1H4 |
| InChIKey | NLAYJSLXDJDFQH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 197.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|