About carbanide;ethane;2,4,6-trimethylpyrylium
carbanide;ethane;2,4,6-trimethylpyrylium (PubChem CID 159811376) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is carbanide;ethane;2,4,6-trimethylpyrylium.
Molecular Properties
| Compound Name | carbanide;ethane;2,4,6-trimethylpyrylium |
| PubChem CID | 159811376 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | carbanide;ethane;2,4,6-trimethylpyrylium |
| SMILES | CC.Cc1cc(C)[o+]c(C)c1.[CH3-] |
| InChI | InChI=1S/C8H11O.C2H6.CH3/c1-6-4-7(2)9-8(3)5-6;1-2;/h4-5H,1-3H3;1-2H3;1H3/q+1;;-1 |
| InChIKey | NLBKIXADXSBBOP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbanide;ethane;2,4,6-trimethylpyrylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;ethane;2,4,6-trimethylpyrylium?
The IUPAC name of carbanide;ethane;2,4,6-trimethylpyrylium (CID 159811376) is carbanide;ethane;2,4,6-trimethylpyrylium.
What is the SMILES notation for carbanide;ethane;2,4,6-trimethylpyrylium?
The canonical SMILES for carbanide;ethane;2,4,6-trimethylpyrylium is CC.Cc1cc(C)[o+]c(C)c1.[CH3-].
What is the InChIKey of carbanide;ethane;2,4,6-trimethylpyrylium?
The InChIKey is NLBKIXADXSBBOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11O.C2H6.CH3/c1-6-4-7(2)9-8(3)5-6;1-2;/h4-5H,1-3H3;1-2H3;1H3/q+1;;-1.
What are the key properties of carbanide;ethane;2,4,6-trimethylpyrylium?
carbanide;ethane;2,4,6-trimethylpyrylium has a molecular weight of 168.28 g/mol, XLogP of 3.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;ethane;2,4,6-trimethylpyrylium is sourced from PubChem (CID 159811376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).