About 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane
2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane (PubChem CID 159811926) has the molecular formula C10H16Cl2N4O
and a molecular weight of 279.17 g/mol. Its IUPAC name is 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane.
Molecular Properties
| Compound Name | 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane |
| PubChem CID | 159811926 |
| Molecular Formula | C10H16Cl2N4O |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane |
| SMILES | C.NC(N)=NNCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H12Cl2N4O.CH4/c10-6-2-1-3-7(11)8(6)16-5-4-14-15-9(12)13;/h1-3,14H,4-5H2,(H4,12,13,15);1H4 |
| InChIKey | NLDGOMBLRYDLHP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane?
The IUPAC name of 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane (CID 159811926) is 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane.
What is the SMILES notation for 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane?
The canonical SMILES for 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane is C.NC(N)=NNCCOc1c(Cl)cccc1Cl.
What is the InChIKey of 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane?
The InChIKey is NLDGOMBLRYDLHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2N4O.CH4/c10-6-2-1-3-7(11)8(6)16-5-4-14-15-9(12)13;/h1-3,14H,4-5H2,(H4,12,13,15);1H4.
What are the key properties of 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane?
2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane has a molecular weight of 279.17 g/mol, XLogP of 1.79, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;methane is sourced from PubChem (CID 159811926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).