About 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid
2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid (PubChem CID 15981236) has the molecular formula C15H13Cl2N3O5
and a molecular weight of 386.19 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid.
Molecular Properties
| Compound Name | 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid |
| PubChem CID | 15981236 |
| Molecular Formula | C15H13Cl2N3O5 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid |
| SMILES | CC(C)c1cc(Oc2c(Cl)cc(NC(=O)C(=O)O)cc2Cl)n[nH]c1=O |
| InChI | InChI=1S/C15H13Cl2N3O5/c1-6(2)8-5-11(19-20-13(8)21)25-12-9(16)3-7(4-10(12)17)18-14(22)15(23)24/h3-6H,1-2H3,(H,18,22)(H,20,21)(H,23,24) |
| InChIKey | AZRFPEWTWCMINZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid?
The IUPAC name of 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid (CID 15981236) is 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid.
What is the SMILES notation for 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid?
The canonical SMILES for 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid is CC(C)c1cc(Oc2c(Cl)cc(NC(=O)C(=O)O)cc2Cl)n[nH]c1=O.
What is the InChIKey of 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid?
The InChIKey is AZRFPEWTWCMINZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2N3O5/c1-6(2)8-5-11(19-20-13(8)21)25-12-9(16)3-7(4-10(12)17)18-14(22)15(23)24/h3-6H,1-2H3,(H,18,22)(H,20,21)(H,23,24).
What are the key properties of 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid?
2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid has a molecular weight of 386.19 g/mol, XLogP of 3.02, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]anilino]-2-oxoacetic acid is sourced from PubChem (CID 15981236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).