C22H20F10N2O2 — CID 159812458
4-(3,3,4,4,4-pentafluorobutan-2-yloxy)benzonitrile;[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)phenyl]methanamine (PubChem CID 159812458) has the molecular formula C22H20F10N2O2 and a molecular weight of 534.39 g/mol. Its IUPAC name is 4-(3,3,4,4,4-pentafluorobutan-2-yloxy)benzonitrile;[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)phenyl]methanamine.
| Compound Name | 4-(3,3,4,4,4-pentafluorobutan-2-yloxy)benzonitrile;[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)phenyl]methanamine |
|---|---|
| PubChem CID | 159812458 |
| Molecular Formula | C22H20F10N2O2 |
| Molecular Weight | 534.39 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 4-(3,3,4,4,4-pentafluorobutan-2-yloxy)benzonitrile;[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)phenyl]methanamine |
| SMILES | CC(Oc1ccc(C#N)cc1)C(F)(F)C(F)(F)F.CC(Oc1ccc(CN)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H12F5NO.C11H8F5NO/c2*1-7(10(12,13)11(14,15)16)18-9-4-2-8(6-17)3-5-9/h2-5,7H,6,17H2,1H3;2-5,7H,1H3 |
| InChIKey | NLEVUPFYUGTPSP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.39 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|