C19H32Cl2N2O4 — CID 159812705
1-(3,5-dichlorophenyl)-N-(2,2-diethoxyethyl)methanimine;2,2-diethoxyethanamine (PubChem CID 159812705) has the molecular formula C19H32Cl2N2O4 and a molecular weight of 423.38 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-N-(2,2-diethoxyethyl)methanimine;2,2-diethoxyethanamine.
| Compound Name | 1-(3,5-dichlorophenyl)-N-(2,2-diethoxyethyl)methanimine;2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 159812705 |
| Molecular Formula | C19H32Cl2N2O4 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-N-(2,2-diethoxyethyl)methanimine;2,2-diethoxyethanamine |
| SMILES | CCOC(C/N=C/c1cc(Cl)cc(Cl)c1)OCC.CCOC(CN)OCC |
| InChI | InChI=1S/C13H17Cl2NO2.C6H15NO2/c1-3-17-13(18-4-2)9-16-8-10-5-11(14)7-12(15)6-10;1-3-8-6(5-7)9-4-2/h5-8,13H,3-4,9H2,1-2H3;6H,3-5,7H2,1-2H3/b16-8+; |
| InChIKey | NLFQVPDMTJWZNH-OHGISNTKSA-N |
| XLogP | 4.16 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|