C27H30N4O2 — CID 15981304
3-[3-[cyclopropylmethyl-(1-oxo-3,7,8,9-tetrahydro-2H-pyrano[3,2-e]isoindol-8-yl)amino]propyl]-2,3-dihydro-1H-indole-5-carbonitrile (PubChem CID 15981304) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-[3-[cyclopropylmethyl-(1-oxo-3,7,8,9-tetrahydro-2H-pyrano[3,2-e]isoindol-8-yl)amino]propyl]-2,3-dihydro-1H-indole-5-carbonitrile.
| Compound Name | 3-[3-[cyclopropylmethyl-(1-oxo-3,7,8,9-tetrahydro-2H-pyrano[3,2-e]isoindol-8-yl)amino]propyl]-2,3-dihydro-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 15981304 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 3-[3-[cyclopropylmethyl-(1-oxo-3,7,8,9-tetrahydro-2H-pyrano[3,2-e]isoindol-8-yl)amino]propyl]-2,3-dihydro-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C(CCCN(CC1CC1)C1COc3ccc4c(c3C1)C(=O)NC4)CN2 |
| InChI | InChI=1S/C27H30N4O2/c28-12-18-5-7-24-22(10-18)19(13-29-24)2-1-9-31(15-17-3-4-17)21-11-23-25(33-16-21)8-6-20-14-30-27(32)26(20)23/h5-8,10,17,19,21,29H,1-4,9,11,13-16H2,(H,30,32) |
| InChIKey | RWDAUNSZAKIDJZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |