About (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate
(3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate (PubChem CID 15981349) has the molecular formula C21H16F2N2O4
and a molecular weight of 398.37 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate.
Molecular Properties
| Compound Name | (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate |
| PubChem CID | 15981349 |
| Molecular Formula | C21H16F2N2O4 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate |
| SMILES | O=C(COc1ccc(C(=O)Nc2ccc(F)cc2)cn1)OCc1cccc(F)c1 |
| InChI | InChI=1S/C21H16F2N2O4/c22-16-5-7-18(8-6-16)25-21(27)15-4-9-19(24-11-15)28-13-20(26)29-12-14-2-1-3-17(23)10-14/h1-11H,12-13H2,(H,25,27) |
| InChIKey | KMOKWTXCNPBSHR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate?
The IUPAC name of (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate (CID 15981349) is (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate.
What is the SMILES notation for (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate?
The canonical SMILES for (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate is O=C(COc1ccc(C(=O)Nc2ccc(F)cc2)cn1)OCc1cccc(F)c1.
What is the InChIKey of (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate?
The InChIKey is KMOKWTXCNPBSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F2N2O4/c22-16-5-7-18(8-6-16)25-21(27)15-4-9-19(24-11-15)28-13-20(26)29-12-14-2-1-3-17(23)10-14/h1-11H,12-13H2,(H,25,27).
What are the key properties of (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate?
(3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate has a molecular weight of 398.37 g/mol, XLogP of 3.73, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate is sourced from PubChem (CID 15981349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).