About 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate
4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate (PubChem CID 15981350) has the molecular formula C24H29FN2O4
and a molecular weight of 428.50 g/mol. Its IUPAC name is 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate.
Molecular Properties
| Compound Name | 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate |
| PubChem CID | 15981350 |
| Molecular Formula | C24H29FN2O4 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate |
| SMILES | O=C(COc1ccc(C(=O)Nc2ccc(F)cc2)cn1)OCCCCC1CCCCC1 |
| InChI | InChI=1S/C24H29FN2O4/c25-20-10-12-21(13-11-20)27-24(29)19-9-14-22(26-16-19)31-17-23(28)30-15-5-4-8-18-6-2-1-3-7-18/h9-14,16,18H,1-8,15,17H2,(H,27,29) |
| InChIKey | KCIRBTXGALUYHT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate?
The IUPAC name of 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate (CID 15981350) is 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate.
What is the SMILES notation for 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate?
The canonical SMILES for 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate is O=C(COc1ccc(C(=O)Nc2ccc(F)cc2)cn1)OCCCCC1CCCCC1.
What is the InChIKey of 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate?
The InChIKey is KCIRBTXGALUYHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29FN2O4/c25-20-10-12-21(13-11-20)27-24(29)19-9-14-22(26-16-19)31-17-23(28)30-15-5-4-8-18-6-2-1-3-7-18/h9-14,16,18H,1-8,15,17H2,(H,27,29).
What are the key properties of 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate?
4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate has a molecular weight of 428.50 g/mol, XLogP of 5.15, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate is sourced from PubChem (CID 15981350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).