C15H20O5 — CID 159814930
ethyl 2-[(3aS,5S,5aR,9aR)-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[3a,3-b]furan-5-yl]acetate (PubChem CID 159814930) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is ethyl 2-[(3aS,5S,5aR,9aR)-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[3a,3-b]furan-5-yl]acetate.
| Compound Name | ethyl 2-[(3aS,5S,5aR,9aR)-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[3a,3-b]furan-5-yl]acetate |
|---|---|
| PubChem CID | 159814930 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | ethyl 2-[(3aS,5S,5aR,9aR)-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[3a,3-b]furan-5-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C[C@]2(O)CC(=O)O[C@@]23CC=CC[C@H]13 |
| InChI | InChI=1S/C15H20O5/c1-2-19-12(16)7-10-8-14(18)9-13(17)20-15(14)6-4-3-5-11(10)15/h3-4,10-11,18H,2,5-9H2,1H3/t10-,11-,14+,15-/m1/s1 |
| InChIKey | NLMPPRZNSXCENF-HKCMKHECSA-N |
| XLogP | 1.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|