About oxygen(2-);praseodymium(3+);nitrate
oxygen(2-);praseodymium(3+);nitrate (PubChem CID 159815165) has the molecular formula NO4Pr
and a molecular weight of 218.91 g/mol. Its IUPAC name is oxygen(2-);praseodymium(3+);nitrate.
Molecular Properties
| Compound Name | oxygen(2-);praseodymium(3+);nitrate |
| PubChem CID | 159815165 |
| Molecular Formula | NO4Pr |
| Molecular Weight | 218.91 g/mol |
| Exact Mass | 218.89 |
| IUPAC Name | oxygen(2-);praseodymium(3+);nitrate |
| SMILES | O=[N+]([O-])[O-].[O-2].[Pr+3] |
| InChI | InChI=1S/NO3.O.Pr/c2-1(3)4;;/q-1;-2;+3 |
| InChIKey | NLNITXWHFSWFCF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 94.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.91 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze oxygen(2-);praseodymium(3+);nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxygen(2-);praseodymium(3+);nitrate?
The IUPAC name of oxygen(2-);praseodymium(3+);nitrate (CID 159815165) is oxygen(2-);praseodymium(3+);nitrate.
What is the SMILES notation for oxygen(2-);praseodymium(3+);nitrate?
The canonical SMILES for oxygen(2-);praseodymium(3+);nitrate is O=[N+]([O-])[O-].[O-2].[Pr+3].
What is the InChIKey of oxygen(2-);praseodymium(3+);nitrate?
The InChIKey is NLNITXWHFSWFCF-UHFFFAOYSA-N. The full InChI is InChI=1S/NO3.O.Pr/c2-1(3)4;;/q-1;-2;+3.
What are the key properties of oxygen(2-);praseodymium(3+);nitrate?
oxygen(2-);praseodymium(3+);nitrate has a molecular weight of 218.91 g/mol, XLogP of -0.36, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxygen(2-);praseodymium(3+);nitrate is sourced from PubChem (CID 159815165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).