C26H48O5 — CID 159815410
(3aR,5R,6S,6aR)-2,2,6-trimethyl-5-[(2R)-2-methylbutyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;(2S,3R,4R,5R)-4-methyl-5-[(2R)-2-methylbutyl]-2-prop-2-enyloxolan-3-ol (PubChem CID 159815410) has the molecular formula C26H48O5 and a molecular weight of 440.67 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2,2,6-trimethyl-5-[(2R)-2-methylbutyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;(2S,3R,4R,5R)-4-methyl-5-[(2R)-2-methylbutyl]-2-prop-2-enyloxolan-3-ol.
| Compound Name | (3aR,5R,6S,6aR)-2,2,6-trimethyl-5-[(2R)-2-methylbutyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;(2S,3R,4R,5R)-4-methyl-5-[(2R)-2-methylbutyl]-2-prop-2-enyloxolan-3-ol |
|---|---|
| PubChem CID | 159815410 |
| Molecular Formula | C26H48O5 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | (3aR,5R,6S,6aR)-2,2,6-trimethyl-5-[(2R)-2-methylbutyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;(2S,3R,4R,5R)-4-methyl-5-[(2R)-2-methylbutyl]-2-prop-2-enyloxolan-3-ol |
| SMILES | C=CC[C@@H]1O[C@H](C[C@H](C)CC)[C@H](C)[C@H]1O.CC[C@@H](C)C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C13H24O3.C13H24O2/c1-6-8(2)7-10-9(3)11-12(14-10)16-13(4,5)15-11;1-5-7-11-13(14)10(4)12(15-11)8-9(3)6-2/h8-12H,6-7H2,1-5H3;5,9-14H,1,6-8H2,2-4H3/t8-,9+,10-,11-,12-;9-,10+,11+,12-,13-/m11/s1 |
| InChIKey | NLNZUPWTHFLWHV-CXGOMYQSSA-N |
| XLogP | 5.70 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|