About azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate)
azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate) (PubChem CID 159815902) has the molecular formula C11H23F6N2O5S3-
and a molecular weight of 473.50 g/mol. Its IUPAC name is azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate).
Molecular Properties
| Compound Name | azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate) |
| PubChem CID | 159815902 |
| Molecular Formula | C11H23F6N2O5S3- |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate) |
| SMILES | CCS(=O)CC[N+]1(C)CCCC1.N.O=S([O-])C(F)(F)F.O=S([O-])C(F)(F)F |
| InChI | InChI=1S/C9H20NOS.2CHF3O2S.H3N/c1-3-12(11)9-8-10(2)6-4-5-7-10;2*2-1(3,4)7(5)6;/h3-9H2,1-2H3;2*(H,5,6);1H3/q+1;;;/p-2 |
| InChIKey | ZIYCIEUEFVVFOA-UHFFFAOYSA-L |
| XLogP | 1.93 |
| TPSA | 132.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate)?
The IUPAC name of azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate) (CID 159815902) is azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate).
What is the SMILES notation for azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate)?
The canonical SMILES for azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate) is CCS(=O)CC[N+]1(C)CCCC1.N.O=S([O-])C(F)(F)F.O=S([O-])C(F)(F)F.
What is the InChIKey of azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate)?
The InChIKey is ZIYCIEUEFVVFOA-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H20NOS.2CHF3O2S.H3N/c1-3-12(11)9-8-10(2)6-4-5-7-10;2*2-1(3,4)7(5)6;/h3-9H2,1-2H3;2*(H,5,6);1H3/q+1;;;/p-2.
What are the key properties of azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate)?
azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate) has a molecular weight of 473.50 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium;bis(trifluoromethanesulfinate) is sourced from PubChem (CID 159815902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).