About 3-indol-1-ylpropan-1-ol
3-indol-1-ylpropan-1-ol (PubChem CID 15981606) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-indol-1-ylpropan-1-ol.
Molecular Properties
| Compound Name | 3-indol-1-ylpropan-1-ol |
| PubChem CID | 15981606 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-indol-1-ylpropan-1-ol |
| SMILES | OCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C11H13NO/c13-9-3-7-12-8-6-10-4-1-2-5-11(10)12/h1-2,4-6,8,13H,3,7,9H2 |
| InChIKey | BOXDPPLUKGIQLV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-indol-1-ylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-indol-1-ylpropan-1-ol?
The IUPAC name of 3-indol-1-ylpropan-1-ol (CID 15981606) is 3-indol-1-ylpropan-1-ol.
What is the SMILES notation for 3-indol-1-ylpropan-1-ol?
The canonical SMILES for 3-indol-1-ylpropan-1-ol is OCCCn1ccc2ccccc21.
What is the InChIKey of 3-indol-1-ylpropan-1-ol?
The InChIKey is BOXDPPLUKGIQLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c13-9-3-7-12-8-6-10-4-1-2-5-11(10)12/h1-2,4-6,8,13H,3,7,9H2.
What are the key properties of 3-indol-1-ylpropan-1-ol?
3-indol-1-ylpropan-1-ol has a molecular weight of 175.23 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-indol-1-ylpropan-1-ol is sourced from PubChem (CID 15981606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).