C19H36O5Si — CID 15981705
methyl (2Z,4E,6R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6-methylnona-2,4-dienoate (PubChem CID 15981705) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is methyl (2Z,4E,6R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6-methylnona-2,4-dienoate.
| Compound Name | methyl (2Z,4E,6R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6-methylnona-2,4-dienoate |
|---|---|
| PubChem CID | 15981705 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | methyl (2Z,4E,6R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6-methylnona-2,4-dienoate |
| SMILES | COCO[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/C=C\C(=O)OC |
| InChI | InChI=1S/C19H36O5Si/c1-16(11-9-10-12-18(20)22-6)17(23-15-21-5)13-14-24-25(7,8)19(2,3)4/h9-12,16-17H,13-15H2,1-8H3/b11-9+,12-10-/t16-,17+/m1/s1 |
| InChIKey | AMZVGPWYJSIISW-ACKNBVCGSA-N |
| XLogP | 4.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|