About molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide
molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide (PubChem CID 159817339) has the molecular formula C7H16N2O4S
and a molecular weight of 224.28 g/mol. Its IUPAC name is molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide |
| PubChem CID | 159817339 |
| Molecular Formula | C7H16N2O4S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC[C@H]1CNC(=O)O1.[H][H] |
| InChI | InChI=1S/C7H14N2O4S.H2/c1-2-3-14(11,12)9-5-6-4-8-7(10)13-6;/h6,9H,2-5H2,1H3,(H,8,10);1H/t6-;/m1./s1 |
| InChIKey | NLTXVCHGMPKFQZ-FYZOBXCZSA-N |
| XLogP | -0.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide?
The IUPAC name of molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide (CID 159817339) is molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide.
What is the SMILES notation for molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide?
The canonical SMILES for molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide is CCCS(=O)(=O)NC[C@H]1CNC(=O)O1.[H][H].
What is the InChIKey of molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide?
The InChIKey is NLTXVCHGMPKFQZ-FYZOBXCZSA-N. The full InChI is InChI=1S/C7H14N2O4S.H2/c1-2-3-14(11,12)9-5-6-4-8-7(10)13-6;/h6,9H,2-5H2,1H3,(H,8,10);1H/t6-;/m1./s1.
What are the key properties of molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide?
molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide has a molecular weight of 224.28 g/mol, XLogP of -0.33, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-[[(5R)-2-oxo-1,3-oxazolidin-5-yl]methyl]propane-1-sulfonamide is sourced from PubChem (CID 159817339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).