C38H53ClN2O6 — CID 159818166
(2S)-2-[[(2R,5S)-5-[[(2R)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]heptanoyl]amino]-2-methyl-4-oxodecanoyl]amino]-4-methylpentanoic acid (PubChem CID 159818166) has the molecular formula C38H53ClN2O6 and a molecular weight of 669.30 g/mol. Its IUPAC name is (2S)-2-[[(2R,5S)-5-[[(2R)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]heptanoyl]amino]-2-methyl-4-oxodecanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2R,5S)-5-[[(2R)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]heptanoyl]amino]-2-methyl-4-oxodecanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 159818166 |
| Molecular Formula | C38H53ClN2O6 |
| Molecular Weight | 669.30 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | (2S)-2-[[(2R,5S)-5-[[(2R)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]heptanoyl]amino]-2-methyl-4-oxodecanoyl]amino]-4-methylpentanoic acid |
| SMILES | CCCCC[C@H](CC(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)N[C@@H](CCCCC)C(=O)C[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C38H53ClN2O6/c1-6-8-10-12-30(24-34(42)29-16-14-27(15-17-29)28-18-20-31(39)21-19-28)37(45)40-32(13-11-9-7-2)35(43)23-26(5)36(44)41-33(38(46)47)22-25(3)4/h14-21,25-26,30,32-33H,6-13,22-24H2,1-5H3,(H,40,45)(H,41,44)(H,46,47)/t26-,30-,32+,33+/m1/s1 |
| InChIKey | AYYZZUYSXMIFLK-KDAKBFSJSA-N |
| XLogP | 8.05 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.30 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|