About 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid
2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid (PubChem CID 159818297) has the molecular formula C9H13Cl2N3O5S
and a molecular weight of 346.19 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid.
Molecular Properties
| Compound Name | 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid |
| PubChem CID | 159818297 |
| Molecular Formula | C9H13Cl2N3O5S |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid |
| SMILES | NC(N)=NCCOc1ccc(Cl)cc1Cl.O=S(=O)(O)O |
| InChI | InChI=1S/C9H11Cl2N3O.H2O4S/c10-6-1-2-8(7(11)5-6)15-4-3-14-9(12)13;1-5(2,3)4/h1-2,5H,3-4H2,(H4,12,13,14);(H2,1,2,3,4) |
| InChIKey | NLXBLJZNFMEUJM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid?
The IUPAC name of 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid (CID 159818297) is 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid.
What is the SMILES notation for 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid?
The canonical SMILES for 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid is NC(N)=NCCOc1ccc(Cl)cc1Cl.O=S(=O)(O)O.
What is the InChIKey of 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid?
The InChIKey is NLXBLJZNFMEUJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl2N3O.H2O4S/c10-6-1-2-8(7(11)5-6)15-4-3-14-9(12)13;1-5(2,3)4/h1-2,5H,3-4H2,(H4,12,13,14);(H2,1,2,3,4).
What are the key properties of 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid?
2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid has a molecular weight of 346.19 g/mol, XLogP of 0.99, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid is sourced from PubChem (CID 159818297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).