2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid

C9H13Cl2N3O5S — CID 159818297

IUPAC2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid
SMILESNC(N)=NCCOc1ccc(Cl)cc1Cl.O=S(=O)(O)O
InChIInChI=1S/C9H11Cl2N3O.H2O4S/c10-6-1-2-8(7(11)5-6)15-4-3-14-9(12)13;1-5(2,3)4/h1-2,5H,3-4H2,(H4,12,13,14);(H2,1,2,3,4)
InChIKeyNLXBLJZNFMEUJM-UHFFFAOYSA-N
MW346.19 g/mol
LogP0.99
Rot. Bonds4

About 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid

2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid (PubChem CID 159818297) has the molecular formula C9H13Cl2N3O5S and a molecular weight of 346.19 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid.

Molecular Properties

Compound Name2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid
PubChem CID159818297
Molecular FormulaC9H13Cl2N3O5S
Molecular Weight346.19 g/mol
Exact Mass345.00
IUPAC Name2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid
SMILESNC(N)=NCCOc1ccc(Cl)cc1Cl.O=S(=O)(O)O
InChIInChI=1S/C9H11Cl2N3O.H2O4S/c10-6-1-2-8(7(11)5-6)15-4-3-14-9(12)13;1-5(2,3)4/h1-2,5H,3-4H2,(H4,12,13,14);(H2,1,2,3,4)
InChIKeyNLXBLJZNFMEUJM-UHFFFAOYSA-N
XLogP0.99
TPSA148.23 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.19
LogP ≤ 50.99
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid?
The IUPAC name of 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid (CID 159818297) is 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid.
What is the SMILES notation for 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid?
The canonical SMILES for 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid is NC(N)=NCCOc1ccc(Cl)cc1Cl.O=S(=O)(O)O.
What is the InChIKey of 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid?
The InChIKey is NLXBLJZNFMEUJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl2N3O.H2O4S/c10-6-1-2-8(7(11)5-6)15-4-3-14-9(12)13;1-5(2,3)4/h1-2,5H,3-4H2,(H4,12,13,14);(H2,1,2,3,4).
What are the key properties of 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid?
2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid has a molecular weight of 346.19 g/mol, XLogP of 0.99, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dichlorophenoxy)ethyl]guanidine;sulfuric acid is sourced from PubChem (CID 159818297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).