C20H40O4Si — CID 15981858
(2R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(oxan-2-yloxy)oct-7-en-4-ol (PubChem CID 15981858) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is (2R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(oxan-2-yloxy)oct-7-en-4-ol.
| Compound Name | (2R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(oxan-2-yloxy)oct-7-en-4-ol |
|---|---|
| PubChem CID | 15981858 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (2R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(oxan-2-yloxy)oct-7-en-4-ol |
| SMILES | C=CC[C@@H](OC1CCCCO1)[C@H](O)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-8-11-18(24-19-12-9-10-13-22-19)17(21)14-16(2)15-23-25(6,7)20(3,4)5/h8,16-19,21H,1,9-15H2,2-7H3/t16-,17-,18-,19?/m1/s1 |
| InChIKey | SOUYYQLWPGUOFV-SLZIBOOSSA-N |
| XLogP | 4.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|