About (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine
(2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine (PubChem CID 159819312) has the molecular formula C10H10F3N
and a molecular weight of 201.19 g/mol. Its IUPAC name is (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine.
Molecular Properties
| Compound Name | (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine |
| PubChem CID | 159819312 |
| Molecular Formula | C10H10F3N |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine |
| SMILES | Fc1ccc([C@H]2CC(F)(F)CN2)cc1 |
| InChI | InChI=1S/C10H10F3N/c11-8-3-1-7(2-4-8)9-5-10(12,13)6-14-9/h1-4,9,14H,5-6H2/t9-/m1/s1 |
| InChIKey | OMHKIFMJBHEIPI-SECBINFHSA-N |
| XLogP | 2.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine?
The IUPAC name of (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine (CID 159819312) is (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine.
What is the SMILES notation for (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine?
The canonical SMILES for (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine is Fc1ccc([C@H]2CC(F)(F)CN2)cc1.
What is the InChIKey of (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine?
The InChIKey is OMHKIFMJBHEIPI-SECBINFHSA-N. The full InChI is InChI=1S/C10H10F3N/c11-8-3-1-7(2-4-8)9-5-10(12,13)6-14-9/h1-4,9,14H,5-6H2/t9-/m1/s1.
What are the key properties of (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine?
(2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine has a molecular weight of 201.19 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4-difluoro-2-(4-fluorophenyl)pyrrolidine is sourced from PubChem (CID 159819312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).