C27H31F6N7O2 — CID 15982189
7-[2-(4-cyclohexylpiperazin-1-yl)-6-(trifluoromethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid (PubChem CID 15982189) has the molecular formula C27H31F6N7O2 and a molecular weight of 599.58 g/mol. Its IUPAC name is 7-[2-(4-cyclohexylpiperazin-1-yl)-6-(trifluoromethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-[2-(4-cyclohexylpiperazin-1-yl)-6-(trifluoromethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 15982189 |
| Molecular Formula | C27H31F6N7O2 |
| Molecular Weight | 599.58 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 7-[2-(4-cyclohexylpiperazin-1-yl)-6-(trifluoromethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CNc1nc(N)nc2nc(-c3c(N4CCN(C5CCCCC5)CC4)cccc3C(F)(F)F)ccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H30F3N7.C2HF3O2/c1-30-22-17-10-11-19(31-23(17)33-24(29)32-22)21-18(25(26,27)28)8-5-9-20(21)35-14-12-34(13-15-35)16-6-3-2-4-7-16;3-2(4,5)1(6)7/h5,8-11,16H,2-4,6-7,12-15H2,1H3,(H3,29,30,31,32,33);(H,6,7) |
| InChIKey | CZIAIZIFEOBFSZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |