C24H41NaO8 — CID 159822245
sodium;[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2,4-trimethyl-1,3-dioxolane-4-carboxylate;2,2,4-trimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 159822245) has the molecular formula C24H41NaO8 and a molecular weight of 480.57 g/mol. Its IUPAC name is sodium;[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2,4-trimethyl-1,3-dioxolane-4-carboxylate;2,2,4-trimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | sodium;[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2,4-trimethyl-1,3-dioxolane-4-carboxylate;2,2,4-trimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 159822245 |
| Molecular Formula | C24H41NaO8 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | sodium;[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2,4-trimethyl-1,3-dioxolane-4-carboxylate;2,2,4-trimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)C1(C)COC(C)(C)O1.CC1(C)OCC(C)(C(=O)[O-])O1.[Na+] |
| InChI | InChI=1S/C17H30O4.C7H12O4.Na/c1-11(2)13-8-7-12(3)9-14(13)20-15(18)17(6)10-19-16(4,5)21-17;1-6(2)10-4-7(3,11-6)5(8)9;/h11-14H,7-10H2,1-6H3;4H2,1-3H3,(H,8,9);/q;;+1/p-1/t12-,13+,14-,17?;;/m1../s1 |
| InChIKey | NMJRONBHPUULRY-GFMSGECXSA-M |
| XLogP | -0.19 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |