About 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone
1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone (PubChem CID 159823154) has the molecular formula C20H27N5O3
and a molecular weight of 385.47 g/mol. Its IUPAC name is 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone.
Molecular Properties
| Compound Name | 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone |
| PubChem CID | 159823154 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone |
| SMILES | CC(=O)c1ccccn1.COC(OC)N(C)C.c1ccc(-c2ccn[nH]2)nc1 |
| InChI | InChI=1S/C8H7N3.C7H7NO.C5H13NO2/c1-2-5-9-7(3-1)8-4-6-10-11-8;1-6(9)7-4-2-3-5-8-7;1-6(2)5(7-3)8-4/h1-6H,(H,10,11);2-5H,1H3;5H,1-4H3 |
| InChIKey | NMMOLTHLGCMTKC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone?
The IUPAC name of 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone (CID 159823154) is 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone.
What is the SMILES notation for 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone?
The canonical SMILES for 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone is CC(=O)c1ccccn1.COC(OC)N(C)C.c1ccc(-c2ccn[nH]2)nc1.
What is the InChIKey of 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone?
The InChIKey is NMMOLTHLGCMTKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.C7H7NO.C5H13NO2/c1-2-5-9-7(3-1)8-4-6-10-11-8;1-6(9)7-4-2-3-5-8-7;1-6(2)5(7-3)8-4/h1-6H,(H,10,11);2-5H,1H3;5H,1-4H3.
What are the key properties of 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone?
1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone has a molecular weight of 385.47 g/mol, XLogP of 2.88, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxy-N,N-dimethylmethanamine;2-(1H-pyrazol-5-yl)pyridine;1-pyridin-2-ylethanone is sourced from PubChem (CID 159823154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).